CAS 13567-19-6 appears in our catalog under these names: 3-(1,2-Oxazol-5-yl)benzene-1-sulfonyl chloride, 95%, 3-(1,2-Oxazol-5-yl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(1,2-oxazol-5-yl)benzenesulfonyl chloride (CAS 13567-19-6) is a chemical compound with the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. IUPAC name: 3-(1,2-oxazol-5-yl)benzenesulfonyl chloride. InChIKey: IMCKOKLNTSTPBX-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 3-(1,2-oxazol-5-yl)benzenesulfonyl chloride |
| InChIKey | IMCKOKLNTSTPBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)C2=CC=NO2 |
Computed by PubChem (NCBI)