CAS 37543-50-3 is the registry number for 3-Phenyl-1,2-oxazole-5-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-phenyl-1,2-oxazole-5-sulfonyl chloride (CAS 37543-50-3) is a chemical compound with the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. IUPAC name: 3-phenyl-1,2-oxazole-5-sulfonyl chloride. InChIKey: NCKNGGKOOAPRLL-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 3-phenyl-1,2-oxazole-5-sulfonyl chloride |
| InChIKey | NCKNGGKOOAPRLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)