CAS 337508-66-4 appears in our catalog under these names: 4-Oxazol-5-yl-benzenesulfonyl chloride, 97%, 4-(1,3-Oxazol-5-yl)benzenesulfonyl chloride, 95%, 4-(Oxazol-5-yl)benzene-1-sulfonyl chloride 97%. Offered by: Fluorochem, Combi-blocks, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(1,3-oxazol-5-yl)benzenesulfonyl chloride (CAS 337508-66-4) is a chemical compound with the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. IUPAC name: 4-(1,3-oxazol-5-yl)benzenesulfonyl chloride. InChIKey: QCGUTLAPXWBIMM-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 4-(1,3-oxazol-5-yl)benzenesulfonyl chloride |
| InChIKey | QCGUTLAPXWBIMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CO2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)