CAS 118742-82-8 is the registry number for 1-Oxo-1,2-dihydroisoquinoline-4-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-oxo-2H-isoquinoline-4-sulfonyl chloride (CAS 118742-82-8) is a chemical compound with the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. IUPAC name: 1-oxo-2H-isoquinoline-4-sulfonyl chloride. InChIKey: CSTPNQIXJYBFCW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 1-oxo-2H-isoquinoline-4-sulfonyl chloride |
| InChIKey | CSTPNQIXJYBFCW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CNC2=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)