CAS 105630-54-4 appears in our catalog under these names: 2,3-Dichloro-4-nitroanisole, 95+%, 2,3-Dichloro-1-methoxy-4-nitrobenzene, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
2,3-dichloro-1-methoxy-4-nitrobenzene (CAS 105630-54-4) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: 2,3-dichloro-1-methoxy-4-nitrobenzene. InChIKey: JXWUMFLJRZJKAZ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | 2,3-dichloro-1-methoxy-4-nitrobenzene |
| InChIKey | JXWUMFLJRZJKAZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)