Products 37693-15-5
CAS 37693-15-5 appears in our catalog under these names: 2,6-Dichloro-3-methyl-4-nitrophenol, 2,6-Dichloro-3-methyl-4-nitrophenol, >95%, >95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
2,6-dichloro-3-methyl-4-nitrophenol (CAS 37693-15-5) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: 2,6-dichloro-3-methyl-4-nitrophenol. InChIKey: BIXNDXIFMLMASZ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | 2,6-dichloro-3-methyl-4-nitrophenol |
| InChIKey | BIXNDXIFMLMASZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1[N+](=O)[O-])Cl)O)Cl |
Computed by PubChem (NCBI)