CAS 74672-01-8 appears in our catalog under these names: 1,5-Dichloro-3-methoxy-2-nitrobenzene, 98%, 1,5-Dichloro-3-methoxy-2-nitrobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,5-dichloro-3-methoxy-2-nitrobenzene (CAS 74672-01-8) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: 1,5-dichloro-3-methoxy-2-nitrobenzene. InChIKey: YVBJIJGYOHMSQV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | 1,5-dichloro-3-methoxy-2-nitrobenzene |
| InChIKey | YVBJIJGYOHMSQV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)