Products 1305324-55-3
CAS 1305324-55-3 appears in our catalog under these names: 2,5-Dichloro-3-methoxyisonicotinic acid, 95%, 2,5-Dichloro-3-methoxyisonicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
2,5-dichloro-3-methoxypyridine-4-carboxylic acid (CAS 1305324-55-3) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: 2,5-dichloro-3-methoxypyridine-4-carboxylic acid. InChIKey: NRXYREZMKGHSQO-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | 2,5-dichloro-3-methoxypyridine-4-carboxylic acid |
| InChIKey | NRXYREZMKGHSQO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CN=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)