Products 393078-37-0
CAS 393078-37-0 appears in our catalog under these names: (2,3-Dichloro-6-nitrophenyl)methanol, 95%, 2,3-Dichloro-6-nitrobenzyl Alcohol, (2,3-Dichloro-6-nitrophenyl)methanol, 95+%, (2，3–Dichloro–6–nitrophenyl)methanol. Offered by: Combi-blocks, TRC, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
(2,3-dichloro-6-nitrophenyl)methanol (CAS 393078-37-0) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: (2,3-dichloro-6-nitrophenyl)methanol. InChIKey: OCSXCROLWYVFAO-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | (2,3-dichloro-6-nitrophenyl)methanol |
| InChIKey | OCSXCROLWYVFAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])CO)Cl)Cl |
Computed by PubChem (NCBI)