Products 160647-01-8
CAS 160647-01-8 appears in our catalog under these names: (2,6-Dichloro-3-nitrophenyl)methanol, 98%, (2,6–Dichloro–3–nitrophenyl)methanol, (2,6-Dichloro-3-nitrophenyl)methanol 98%, (2，6-Dichloro-3-nitrophenyl)methanol, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 50g.
(2,6-dichloro-3-nitrophenyl)methanol (CAS 160647-01-8) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: (2,6-dichloro-3-nitrophenyl)methanol. InChIKey: SBOJVVSPAOOEEB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | (2,6-dichloro-3-nitrophenyl)methanol |
| InChIKey | SBOJVVSPAOOEEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)CO)Cl |
Computed by PubChem (NCBI)