CAS 105763-77-7 appears in our catalog under these names: 2,4-Dichloro-6-methoxyquinazoline 97%, 2,4-Dichloro-6-methoxyquinazoline, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 25g, 250mg, 10g.
2,4-dichloro-6-methoxyquinazoline (CAS 105763-77-7) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2,4-dichloro-6-methoxyquinazoline. InChIKey: WEAMQTSRMCCGSJ-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,4-dichloro-6-methoxyquinazoline |
| InChIKey | WEAMQTSRMCCGSJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)