Products 1057652-84-2
CAS 1057652-84-2 is the registry number for Methyl 3-chloro-4-methyl-5-nitrobenzoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 3-chloro-4-methyl-5-nitrobenzoate (CAS 1057652-84-2) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: methyl 3-chloro-4-methyl-5-nitrobenzoate. InChIKey: ZBLLUDZWJWIWIU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | methyl 3-chloro-4-methyl-5-nitrobenzoate |
| InChIKey | ZBLLUDZWJWIWIU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)