CAS 1057672-27-1 is the registry number for 4-(2,6-Difluorophenyl)butanenitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2,6-difluorophenyl)butanenitrile (CAS 1057672-27-1) is a chemical compound with the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. IUPAC name: 4-(2,6-difluorophenyl)butanenitrile. InChIKey: ZGYOXFFRLYVGFO-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | 4-(2,6-difluorophenyl)butanenitrile |
| InChIKey | ZGYOXFFRLYVGFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CCCC#N)F |
Computed by PubChem (NCBI)