CAS 1443623-92-4 appears in our catalog under these names: 5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole, 95%, 95%, 5-(2,5-Difluorophenyl)-3,4-dihydro-2H-pyrrole, 98%, 5-(2,5-Difluorophenyl)-3,4-dihydro-2H-pyrrole, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole (CAS 1443623-92-4) is a chemical compound with the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. IUPAC name: 5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole. InChIKey: QIZHVCUPPAMGIW-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | 5-(2,5-difluorophenyl)-3,4-dihydro-2H-pyrrole |
| InChIKey | QIZHVCUPPAMGIW-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)