Products 871792-62-0
CAS 871792-62-0 appears in our catalog under these names: 6,7-Difluoro-1,2,3,4-tetrahydronaphthalen-1,4-imine, 6,7-Difluoro-1,2,3,4-tetrahydro-1,4-epiminonaphthalene, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4,5-difluoro-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene (CAS 871792-62-0) is a chemical compound with the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. IUPAC name: 4,5-difluoro-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene. InChIKey: ILUHWOGJIRJYTJ-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | 4,5-difluoro-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| InChIKey | ILUHWOGJIRJYTJ-UHFFFAOYSA-N |
| SMILES | C1CC2C3=CC(=C(C=C3C1N2)F)F |
Computed by PubChem (NCBI)