Products 1780191-22-1
CAS 1780191-22-1 is the registry number for 2-(4-(1,1-difluoroethyl)phenyl)acetonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(1,1-difluoroethyl)phenyl]acetonitrile (CAS 1780191-22-1) is a chemical compound with the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. IUPAC name: 2-[4-(1,1-difluoroethyl)phenyl]acetonitrile. InChIKey: VFRBSCFNAFAFFI-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | 2-[4-(1,1-difluoroethyl)phenyl]acetonitrile |
| InChIKey | VFRBSCFNAFAFFI-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)CC#N)(F)F |
Computed by PubChem (NCBI)