Products 1602204-87-4
CAS 1602204-87-4 is the registry number for 1-(Difluoromethyl)-4-methyl-1H-indole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(difluoromethyl)-4-methylindole (CAS 1602204-87-4) is a chemical compound with the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. IUPAC name: 1-(difluoromethyl)-4-methylindole. InChIKey: AIYRJYCAXREKPI-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | 1-(difluoromethyl)-4-methylindole |
| InChIKey | AIYRJYCAXREKPI-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CN(C2=CC=C1)C(F)F |
Computed by PubChem (NCBI)