CAS 1035262-16-8 is the registry number for 2-(3,4-Difluorophenyl)-2-methylpropanenitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(3,4-difluorophenyl)-2-methylpropanenitrile (CAS 1035262-16-8) is a chemical compound with the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-2-methylpropanenitrile. InChIKey: VDWLNFKRCLDVEX-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-2-methylpropanenitrile |
| InChIKey | VDWLNFKRCLDVEX-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)