CAS 1360936-91-9 is the registry number for 3-Ethyl-4,6-difluoro-1H-indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-ethyl-4,6-difluoro-1H-indole (CAS 1360936-91-9) is a chemical compound with the molecular formula C10H9F2N and a molecular weight of 181.18 g/mol. IUPAC name: 3-ethyl-4,6-difluoro-1H-indole. InChIKey: UIFPXAFABSHBLX-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N |
|---|---|
| Molecular weight | 181.18 g/mol |
| IUPAC name | 3-ethyl-4,6-difluoro-1H-indole |
| InChIKey | UIFPXAFABSHBLX-UHFFFAOYSA-N |
| SMILES | CCC1=CNC2=C1C(=CC(=C2)F)F |
Computed by PubChem (NCBI)