CAS 1057676-06-8 appears in our catalog under these names: 4-(3-(Trifluoromethyl)phenyl)butanenitrile, 95%, 4-(3-(Trifluoromethyl)phenyl)butanenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[3-(trifluoromethyl)phenyl]butanenitrile (CAS 1057676-06-8) is a chemical compound with the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenyl]butanenitrile. InChIKey: MJLKOKAURMZPFG-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenyl]butanenitrile |
| InChIKey | MJLKOKAURMZPFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCCC#N |
Computed by PubChem (NCBI)