Products 1225380-06-2
CAS 1225380-06-2 is the registry number for 4-(1,1,1-Trifluoro-2-methylpropan-2-yl)benzonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzonitrile (CAS 1225380-06-2) is a chemical compound with the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. IUPAC name: 4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzonitrile. InChIKey: HWQIWGYRCIILHQ-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzonitrile |
| InChIKey | HWQIWGYRCIILHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)