Products 130360-88-2
CAS 130360-88-2 is the registry number for 5-(3-(Trifluoromethyl)phenyl)-3,4-dihydro-2H-pyrrole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrrole (CAS 130360-88-2) is a chemical compound with the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. IUPAC name: 5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrrole. InChIKey: IAPOJKFGBNZAHD-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 5-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-pyrrole |
| InChIKey | IAPOJKFGBNZAHD-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)