Products 1823903-80-5
CAS 1823903-80-5 is the registry number for 6'–(TRIFLUOROMETHYL)SPIRO(CYCLOPROPANE–1，3'–INDOLINE). Offered by: GLPBio. Available pack sizes: 1g.
6-(trifluoromethyl)spiro[1,2-dihydroindole-3,1'-cyclopropane] (CAS 1823903-80-5) is a chemical compound with the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[1,2-dihydroindole-3,1'-cyclopropane]. InChIKey: NNBZNTAOQDCJCQ-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[1,2-dihydroindole-3,1'-cyclopropane] |
| InChIKey | NNBZNTAOQDCJCQ-UHFFFAOYSA-N |
| SMILES | C1CC12CNC3=C2C=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)