CAS 81558-20-5 is the registry number for 2,3-Dimethyl-6-trifluoromethyl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
2,3-dimethyl-6-(trifluoromethyl)-1H-indole (CAS 81558-20-5) is a chemical compound with the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. IUPAC name: 2,3-dimethyl-6-(trifluoromethyl)-1H-indole. InChIKey: CGTILMKGSYZOAF-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 2,3-dimethyl-6-(trifluoromethyl)-1H-indole |
| InChIKey | CGTILMKGSYZOAF-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=CC(=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)