Products 1823881-89-5
CAS 1823881-89-5 appears in our catalog under these names: 4'-(Trifluoromethyl)spiro[cyclopropane-1,3'-indoline], 95%, 4'–(TRIFLUOROMETHYL)SPIRO(CYCLOPROPANE–1，3'–INDOLINE). Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
4-(trifluoromethyl)spiro[1,2-dihydroindole-3,1'-cyclopropane] (CAS 1823881-89-5) is a chemical compound with the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. IUPAC name: 4-(trifluoromethyl)spiro[1,2-dihydroindole-3,1'-cyclopropane]. InChIKey: AANQQDUYCFQKCM-UHFFFAOYSA-N.
| Molecular formula | C11H10F3N |
|---|---|
| Molecular weight | 213.20 g/mol |
| IUPAC name | 4-(trifluoromethyl)spiro[1,2-dihydroindole-3,1'-cyclopropane] |
| InChIKey | AANQQDUYCFQKCM-UHFFFAOYSA-N |
| SMILES | C1CC12CNC3=CC=CC(=C23)C(F)(F)F |
Computed by PubChem (NCBI)