CAS 105859-44-7 is the registry number for (2R)-Methyl 3-{(tert-Butyldimethylsilyl)oxy)}-2-methylpropionate. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1g, 0,5g.
Methyl (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropanoate (CAS 105859-44-7) is a chemical compound with the molecular formula C11H24O3Si and a molecular weight of 232.39 g/mol. IUPAC name: methyl (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropanoate. InChIKey: GDTYFCRFIVSEIF-SECBINFHSA-N.
| Molecular formula | C11H24O3Si |
|---|---|
| Molecular weight | 232.39 g/mol |
| IUPAC name | methyl (2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropanoate |
| InChIKey | GDTYFCRFIVSEIF-SECBINFHSA-N |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)