CAS 169904-58-9 is the registry number for Ethyl (R)-2-((Tert-Butyldimethylsilyl)Oxy)Propanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
Ethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate (CAS 169904-58-9) is a chemical compound with the molecular formula C11H24O3Si and a molecular weight of 232.39 g/mol. IUPAC name: ethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate. InChIKey: KOBAXFIJEBLKRZ-SECBINFHSA-N.
| Molecular formula | C11H24O3Si |
|---|---|
| Molecular weight | 232.39 g/mol |
| IUPAC name | ethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate |
| InChIKey | KOBAXFIJEBLKRZ-SECBINFHSA-N |
| SMILES | CCOC(=O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)