Products 87729-39-3
CAS 87729-39-3 appears in our catalog under these names: 5-((tert-Butyldimethylsilyl)oxy)pentanoic acid, 97%, 97%, 5-((tert-Butyldimethylsilyl)oxy)pentanoic acid, 97.0%, 5-((tert-Butyldimethylsilyl)oxy)pentanoic acid, 97%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 250 mg, 500 mg, 1 g, 100 mg.
5-[tert-butyl(dimethyl)silyl]oxypentanoic acid (CAS 87729-39-3) is a chemical compound with the molecular formula C11H24O3Si and a molecular weight of 232.39 g/mol. IUPAC name: 5-[tert-butyl(dimethyl)silyl]oxypentanoic acid. InChIKey: SHPDANKLQUNHLA-UHFFFAOYSA-N.
| Molecular formula | C11H24O3Si |
|---|---|
| Molecular weight | 232.39 g/mol |
| IUPAC name | 5-[tert-butyl(dimethyl)silyl]oxypentanoic acid |
| InChIKey | SHPDANKLQUNHLA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC(=O)O |
Computed by PubChem (NCBI)