CAS 2514723-88-5 is the registry number for 2-(((1,1-Dimethylethyl)dimethylsilyl)oxy)-butanoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 5g.
Methyl 2-[tert-butyl(dimethyl)silyl]oxybutanoate (CAS 2514723-88-5) is a chemical compound with the molecular formula C11H24O3Si and a molecular weight of 232.39 g/mol. IUPAC name: methyl 2-[tert-butyl(dimethyl)silyl]oxybutanoate. InChIKey: CKTJOTRKSNSBFR-UHFFFAOYSA-N.
| Molecular formula | C11H24O3Si |
|---|---|
| Molecular weight | 232.39 g/mol |
| IUPAC name | methyl 2-[tert-butyl(dimethyl)silyl]oxybutanoate |
| InChIKey | CKTJOTRKSNSBFR-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)OC)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)