Products 2514723-88-5

CAS 2514723-88-5 is the registry number for 2-(((1,1-Dimethylethyl)dimethylsilyl)oxy)-butanoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Methyl 2-[tert-butyl(dimethyl)silyl]oxybutanoate (CAS 2514723-88-5) is a chemical compound with the molecular formula C11H24O3Si and a molecular weight of 232.39 g/mol. IUPAC name: methyl 2-[tert-butyl(dimethyl)silyl]oxybutanoate. InChIKey: CKTJOTRKSNSBFR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H24O3Si
Molecular weight232.39 g/mol
IUPAC namemethyl 2-[tert-butyl(dimethyl)silyl]oxybutanoate
InChIKeyCKTJOTRKSNSBFR-UHFFFAOYSA-N
SMILESCCC(C(=O)OC)O[Si](C)(C)C(C)(C)C

Computed by PubChem (NCBI)