CAS 218615-21-5 is the registry number for (3S)-3-{(tert-Butyl(dimethyl)silyl)oxy}-5-hydroxypentan-2-one. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-one (CAS 218615-21-5) is a chemical compound with the molecular formula C11H24O3Si and a molecular weight of 232.39 g/mol. IUPAC name: (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-one. InChIKey: UUSDHTAHRYBCMB-JTQLQIEISA-N.
| Molecular formula | C11H24O3Si |
|---|---|
| Molecular weight | 232.39 g/mol |
| IUPAC name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypentan-2-one |
| InChIKey | UUSDHTAHRYBCMB-JTQLQIEISA-N |
| SMILES | CC(=O)[C@H](CCO)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)