CAS 2306264-51-5 is the registry number for (3-{((tert-butyldimethylsilyl)oxy)methyl}oxetan-3-yl)methanol. Offered by: AmBeed. Available pack sizes: 5g, 1g.
[3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-yl]methanol (CAS 2306264-51-5) is a chemical compound with the molecular formula C11H24O3Si and a molecular weight of 232.39 g/mol. IUPAC name: [3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-yl]methanol. InChIKey: NDCDMTFOLCEMMP-UHFFFAOYSA-N.
| Molecular formula | C11H24O3Si |
|---|---|
| Molecular weight | 232.39 g/mol |
| IUPAC name | [3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetan-3-yl]methanol |
| InChIKey | NDCDMTFOLCEMMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1(COC1)CO |
Computed by PubChem (NCBI)