Products 105917-74-6
CAS 105917-74-6 is the registry number for 2,3-dichloro-4-(methylthio)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3-dichloro-4-methylsulfanylbenzoic acid (CAS 105917-74-6) is a chemical compound with the molecular formula C8H6Cl2O2S and a molecular weight of 237.10 g/mol. IUPAC name: 2,3-dichloro-4-methylsulfanylbenzoic acid. InChIKey: LHDQVHWRDCUBGQ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2S |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 2,3-dichloro-4-methylsulfanylbenzoic acid |
| InChIKey | LHDQVHWRDCUBGQ-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,3-Dichloro-4-(methylthio)benZoic acid