CAS 52147-98-5 appears in our catalog under these names: 2-(4-Chlorophenyl)ethylenesulfonyl chloride, 95%, (E)-2-(4-Chlorophenyl)ethene-1-sulfonyl chloride, 98%, 2-(4-Chlorophenyl)ethene-1-sulfonyl chloride, (E)-2-(4-Chlorophenyl)ethene-1-sulfonyl chloride, 97%, 97%, (E)-2-(4-chlorophenyl)ethylenesulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g, 100mg, 500mg.
(E)-2-(4-chlorophenyl)ethenesulfonyl chloride (CAS 52147-98-5) is a chemical compound with the molecular formula C8H6Cl2O2S and a molecular weight of 237.10 g/mol. IUPAC name: (E)-2-(4-chlorophenyl)ethenesulfonyl chloride. InChIKey: HVBRPCXLQIUQLT-AATRIKPKSA-N.
| Molecular formula | C8H6Cl2O2S |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | (E)-2-(4-chlorophenyl)ethenesulfonyl chloride |
| InChIKey | HVBRPCXLQIUQLT-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)