CAS 7720-41-4 is the registry number for (2,4-Dichloro-phenylsulfanyl)-acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(2,4-dichlorophenyl)sulfanylacetic acid (CAS 7720-41-4) is a chemical compound with the molecular formula C8H6Cl2O2S and a molecular weight of 237.10 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)sulfanylacetic acid. InChIKey: MDQZIQPTGRZCOQ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2S |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)sulfanylacetic acid |
| InChIKey | MDQZIQPTGRZCOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)SCC(=O)O |
Computed by PubChem (NCBI)