CAS 51521-99-4 is the registry number for 2,4-Dichloro-5-(methylsulfanyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,4-dichloro-5-methylsulfanylbenzoic acid (CAS 51521-99-4) is a chemical compound with the molecular formula C8H6Cl2O2S and a molecular weight of 237.10 g/mol. IUPAC name: 2,4-dichloro-5-methylsulfanylbenzoic acid. InChIKey: OLEVMMVZQSLUHP-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2S |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 2,4-dichloro-5-methylsulfanylbenzoic acid |
| InChIKey | OLEVMMVZQSLUHP-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C(=C1)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)