CAS 335281-13-5 is the registry number for 2-(2-Chlorophenyl)ethene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(E)-2-(2-chlorophenyl)ethenesulfonyl chloride (CAS 335281-13-5) is a chemical compound with the molecular formula C8H6Cl2O2S and a molecular weight of 237.10 g/mol. IUPAC name: (E)-2-(2-chlorophenyl)ethenesulfonyl chloride. InChIKey: AUJUFTDORPTZBS-AATRIKPKSA-N.
| Molecular formula | C8H6Cl2O2S |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | (E)-2-(2-chlorophenyl)ethenesulfonyl chloride |
| InChIKey | AUJUFTDORPTZBS-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)