Products 335281-13-5

CAS 335281-13-5 is the registry number for 2-(2-Chlorophenyl)ethene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(E)-2-(2-chlorophenyl)ethenesulfonyl chloride (CAS 335281-13-5) is a chemical compound with the molecular formula C8H6Cl2O2S and a molecular weight of 237.10 g/mol. IUPAC name: (E)-2-(2-chlorophenyl)ethenesulfonyl chloride. InChIKey: AUJUFTDORPTZBS-AATRIKPKSA-N.

Identity
Molecular formulaC8H6Cl2O2S
Molecular weight237.10 g/mol
IUPAC name(E)-2-(2-chlorophenyl)ethenesulfonyl chloride
InChIKeyAUJUFTDORPTZBS-AATRIKPKSA-N
SMILESC1=CC=C(C(=C1)/C=C/S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)