CAS 6274-27-7 appears in our catalog under these names: 2,5-Dichlorophenylthioglycolic acid, 97%, 2-((2,5-Dichlorophenyl)thio)acetic acid, 97%, 2,5–Dichlorophenylthioglycolic Acid, 2,5-Dichlorophenylthioglycolic Acid, 2,5-Dichlorophenylthioglycolic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 100g, 1g, 5g, 2,5g, 0,25g.
2-(2,5-dichlorophenyl)sulfanylacetic acid (CAS 6274-27-7) is a chemical compound with the molecular formula C8H6Cl2O2S and a molecular weight of 237.10 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)sulfanylacetic acid. InChIKey: DCXXCTCEJFBLPD-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2S |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)sulfanylacetic acid |
| InChIKey | DCXXCTCEJFBLPD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)SCC(=O)O)Cl |
Computed by PubChem (NCBI)