Products 6274-27-7

CAS 6274-27-7 appears in our catalog under these names: 2,5-Dichlorophenylthioglycolic acid, 97%, 2-((2,5-Dichlorophenyl)thio)acetic acid, 97%, 2,5–Dichlorophenylthioglycolic Acid, 2,5-Dichlorophenylthioglycolic Acid, 2,5-Dichlorophenylthioglycolic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 100g, 1g, 5g, 2,5g, 0,25g.

Structural formula: {0} (CAS {1})

2-(2,5-dichlorophenyl)sulfanylacetic acid (CAS 6274-27-7) is a chemical compound with the molecular formula C8H6Cl2O2S and a molecular weight of 237.10 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)sulfanylacetic acid. InChIKey: DCXXCTCEJFBLPD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Cl2O2S
Molecular weight237.10 g/mol
IUPAC name2-(2,5-dichlorophenyl)sulfanylacetic acid
InChIKeyDCXXCTCEJFBLPD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)SCC(=O)O)Cl

Computed by PubChem (NCBI)