CAS 106014-21-5 appears in our catalog under these names: Dimethyl 3–chloropyridine–2,5–dicarboxylate, Dimethyl 3-chloropyridine-2,5-dicarboxylate, 98%, 98%, Dimethyl 3-chloropyridine-2,5-dicarboxylate, 95%, Dimethyl 3-chloropyridine-2,5-dicarboxylate, 96%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
Dimethyl 3-chloropyridine-2,5-dicarboxylate (CAS 106014-21-5) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: dimethyl 3-chloropyridine-2,5-dicarboxylate. InChIKey: SINDYKCLGNROTL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | dimethyl 3-chloropyridine-2,5-dicarboxylate |
| InChIKey | SINDYKCLGNROTL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)