CAS 373384-14-6 appears in our catalog under these names: N,N-Dimethylbenzamide-3-boronic acid/ 95+%, 3-(Dimethylcarbamoyl)phenylboronic Acid (contains varying amounts of Anhydride), (3-(Dimethylcarbamoyl)phenyl)boronic acid 98%, N,N-Dimethylbenzamide-3-boronic acid, 97%. Offered by: Chemat, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
[3-(dimethylcarbamoyl)phenyl]boronic acid (CAS 373384-14-6) is a chemical compound with the molecular formula C9H12BNO3 and a molecular weight of 193.01 g/mol. IUPAC name: [3-(dimethylcarbamoyl)phenyl]boronic acid. InChIKey: DCXXIDMHTQDSLY-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO3 |
|---|---|
| Molecular weight | 193.01 g/mol |
| IUPAC name | [3-(dimethylcarbamoyl)phenyl]boronic acid |
| InChIKey | DCXXIDMHTQDSLY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)