CAS 405520-68-5 appears in our catalog under these names: 4–(Dimethylcarbamoyl)benzeneboronic acid(contains varying amounts of Anhydride), 4-(Dimethylcarbamoyl)phenylboronic Acid (contains varying amounts of Anhydride), >97.0%(T), 4-(N,N-Dimethylaminocarbonyl)phenylboronic acid 97%, 4-(DIMETHYLCARBAMOYL)PHENYLBORONIC ACID&, (4-(Dimethylcarbamoyl)phenyl)boronic acid, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g, 50g, 500g.
[4-(dimethylcarbamoyl)phenyl]boronic acid (CAS 405520-68-5) is a chemical compound with the molecular formula C9H12BNO3 and a molecular weight of 193.01 g/mol. IUPAC name: [4-(dimethylcarbamoyl)phenyl]boronic acid. InChIKey: QJYYVSIRDJVQJW-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO3 |
|---|---|
| Molecular weight | 193.01 g/mol |
| IUPAC name | [4-(dimethylcarbamoyl)phenyl]boronic acid |
| InChIKey | QJYYVSIRDJVQJW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)