CAS 106141-11-1 appears in our catalog under these names: 2-Bromophenyl 3-chloro-2,2-dimethylpropanoate, 95%, 2-Bromophenyl 3-chloro-2,2-dimethylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
(2-bromophenyl) 3-chloro-2,2-dimethylpropanoate (CAS 106141-11-1) is a chemical compound with the molecular formula C11H12BrClO2 and a molecular weight of 291.57 g/mol. IUPAC name: (2-bromophenyl) 3-chloro-2,2-dimethylpropanoate. InChIKey: HLCSQWHQAHSYJV-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO2 |
|---|---|
| Molecular weight | 291.57 g/mol |
| IUPAC name | (2-bromophenyl) 3-chloro-2,2-dimethylpropanoate |
| InChIKey | HLCSQWHQAHSYJV-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)C(=O)OC1=CC=CC=C1Br |
Computed by PubChem (NCBI)