Products 2364584-69-8
CAS 2364584-69-8 appears in our catalog under these names: Propan-2-yl 3-bromo-4-chloro-5-methylbenzoate, 95%, Propan-2-yl 3-bromo-4-chloro-5-methylbenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Propan-2-yl 3-bromo-4-chloro-5-methylbenzoate (CAS 2364584-69-8) is a chemical compound with the molecular formula C11H12BrClO2 and a molecular weight of 291.57 g/mol. IUPAC name: propan-2-yl 3-bromo-4-chloro-5-methylbenzoate. InChIKey: JMNAQNWPNQSFRK-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO2 |
|---|---|
| Molecular weight | 291.57 g/mol |
| IUPAC name | propan-2-yl 3-bromo-4-chloro-5-methylbenzoate |
| InChIKey | JMNAQNWPNQSFRK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)Br)C(=O)OC(C)C |
Computed by PubChem (NCBI)