Products 1873791-28-6
CAS 1873791-28-6 appears in our catalog under these names: tert-Butyl 2-bromo-4-chlorobenzoate, 95%, tert-Butyl 2-bromo-4-chlorobenzoate, 98%, tert-Butyl 2-bromo-4-chlorobenzoate, tert-Butyl 2-bromo-4-chlorobenzoate 98%, tert-Butyl 2-bromo-4-chlorobenzoate, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
Tert-butyl 2-bromo-4-chlorobenzoate (CAS 1873791-28-6) is a chemical compound with the molecular formula C11H12BrClO2 and a molecular weight of 291.57 g/mol. IUPAC name: tert-butyl 2-bromo-4-chlorobenzoate. InChIKey: DVBLOOUJHBSMDI-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO2 |
|---|---|
| Molecular weight | 291.57 g/mol |
| IUPAC name | tert-butyl 2-bromo-4-chlorobenzoate |
| InChIKey | DVBLOOUJHBSMDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)