CAS 1870857-76-3 is the registry number for tert-Butyl 3-bromo-5-chlorobenzoate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Tert-butyl 3-bromo-5-chlorobenzoate (CAS 1870857-76-3) is a chemical compound with the molecular formula C11H12BrClO2 and a molecular weight of 291.57 g/mol. IUPAC name: tert-butyl 3-bromo-5-chlorobenzoate. InChIKey: MVPSGHOHTFZSTA-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO2 |
|---|---|
| Molecular weight | 291.57 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-chlorobenzoate |
| InChIKey | MVPSGHOHTFZSTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)