Products 916904-25-1

CAS 916904-25-1 is the registry number for tert-Butyl 2-bromo-5-chlorobenzoate, 98%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-bromo-5-chlorobenzoate (CAS 916904-25-1) is a chemical compound with the molecular formula C11H12BrClO2 and a molecular weight of 291.57 g/mol. IUPAC name: tert-butyl 2-bromo-5-chlorobenzoate. InChIKey: ZFBPYMGXXWVDTD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12BrClO2
Molecular weight291.57 g/mol
IUPAC nametert-butyl 2-bromo-5-chlorobenzoate
InChIKeyZFBPYMGXXWVDTD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(C=CC(=C1)Cl)Br

Computed by PubChem (NCBI)