CAS 1880289-79-1 is the registry number for tert-Butyl 3-bromo-2-chlorobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-bromo-2-chlorobenzoate (CAS 1880289-79-1) is a chemical compound with the molecular formula C11H12BrClO2 and a molecular weight of 291.57 g/mol. IUPAC name: tert-butyl 3-bromo-2-chlorobenzoate. InChIKey: JBVJKLDCIWEHNT-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO2 |
|---|---|
| Molecular weight | 291.57 g/mol |
| IUPAC name | tert-butyl 3-bromo-2-chlorobenzoate |
| InChIKey | JBVJKLDCIWEHNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=CC=C1)Br)Cl |
Computed by PubChem (NCBI)