Products 106149-18-2
CAS 106149-18-2 is the registry number for N-(4-Phenoxyphenyl)benzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
N-(4-phenoxyphenyl)benzenesulfonamide (CAS 106149-18-2) is a chemical compound with the molecular formula C18H15NO3S and a molecular weight of 325.4 g/mol. IUPAC name: N-(4-phenoxyphenyl)benzenesulfonamide. InChIKey: TYMJYOJIIUAOJI-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | N-(4-phenoxyphenyl)benzenesulfonamide |
| InChIKey | TYMJYOJIIUAOJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)NS(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)