CAS 748786-57-4 appears in our catalog under these names: 3-(1,3-Benzothiazol-2-yl)-4-(4-methoxyphenyl)but-3-enoic acid, TLSC702, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
(E)-3-(1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)but-3-enoic acid (CAS 748786-57-4) is a chemical compound with the molecular formula C18H15NO3S and a molecular weight of 325.4 g/mol. IUPAC name: (E)-3-(1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)but-3-enoic acid. InChIKey: SONSOTYJHQIJQV-JLHYYAGUSA-N.
| Molecular formula | C18H15NO3S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (E)-3-(1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)but-3-enoic acid |
| InChIKey | SONSOTYJHQIJQV-JLHYYAGUSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C(\CC(=O)O)/C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)