Products 1965304-86-2
CAS 1965304-86-2 is the registry number for Ethyl 2-(4-hydroxyphenyl)-4-phenylthiazole-5-carboxylate. Offered by: Fluorochem. Available pack sizes: 250mg.
Ethyl 2-(4-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxylate (CAS 1965304-86-2) is a chemical compound with the molecular formula C18H15NO3S and a molecular weight of 325.4 g/mol. IUPAC name: ethyl 2-(4-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxylate. InChIKey: DIVGZFXXGXUFIZ-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | ethyl 2-(4-hydroxyphenyl)-4-phenyl-1,3-thiazole-5-carboxylate |
| InChIKey | DIVGZFXXGXUFIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=CC=C(C=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)