CAS 748786-62-1 appears in our catalog under these names: 3-Benzothiazol-2-yl-4-(2-methoxy-phenyl)-but-3-enoic acid, 95%, 3-(1,3-Benzothiazol-2-yl)-4-(2-methoxyphenyl)but-3-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-3-(1,3-benzothiazol-2-yl)-4-(2-methoxyphenyl)but-3-enoic acid (CAS 748786-62-1) is a chemical compound with the molecular formula C18H15NO3S and a molecular weight of 325.4 g/mol. IUPAC name: (E)-3-(1,3-benzothiazol-2-yl)-4-(2-methoxyphenyl)but-3-enoic acid. InChIKey: MZMAWAFRVUUPQG-JLHYYAGUSA-N.
| Molecular formula | C18H15NO3S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (E)-3-(1,3-benzothiazol-2-yl)-4-(2-methoxyphenyl)but-3-enoic acid |
| InChIKey | MZMAWAFRVUUPQG-JLHYYAGUSA-N |
| SMILES | COC1=CC=CC=C1/C=C(\CC(=O)O)/C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)